C19H50O5Si5 — CID 20771462
[dimethyl(trimethylsilyloxy)silyl]oxy-(methoxy-methyl-trimethylsilyloxysilyl)oxy-methyl-octylsilane (PubChem CID 20771462) has the molecular formula C19H50O5Si5 and a molecular weight of 499.03 g/mol. Its IUPAC name is [dimethyl(trimethylsilyloxy)silyl]oxy-(methoxy-methyl-trimethylsilyloxysilyl)oxy-methyl-octylsilane.
| Compound Name | [dimethyl(trimethylsilyloxy)silyl]oxy-(methoxy-methyl-trimethylsilyloxysilyl)oxy-methyl-octylsilane |
|---|---|
| PubChem CID | 20771462 |
| Molecular Formula | C19H50O5Si5 |
| Molecular Weight | 499.03 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | [dimethyl(trimethylsilyloxy)silyl]oxy-(methoxy-methyl-trimethylsilyloxysilyl)oxy-methyl-octylsilane |
| SMILES | CCCCCCCC[Si](C)(O[Si](C)(C)O[Si](C)(C)C)O[Si](C)(OC)O[Si](C)(C)C |
| InChI | InChI=1S/C19H50O5Si5/c1-13-14-15-16-17-18-19-28(11,23-27(9,10)21-25(3,4)5)24-29(12,20-2)22-26(6,7)8/h13-19H2,1-12H3 |
| InChIKey | XGCVAJZSJUXGIN-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.03 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|