C26H64O8Si6 — CID 160501197
trimethyl-[methyl-[3-(oxiran-2-ylmethoxy)propyl]-trimethylsilyloxysilyl]oxysilane;trimethyl-[3-(oxiran-2-ylmethoxy)propylsilyl-trimethylsilyloxymethoxy]silane (PubChem CID 160501197) has the molecular formula C26H64O8Si6 and a molecular weight of 673.31 g/mol. Its IUPAC name is trimethyl-[methyl-[3-(oxiran-2-ylmethoxy)propyl]-trimethylsilyloxysilyl]oxysilane;trimethyl-[3-(oxiran-2-ylmethoxy)propylsilyl-trimethylsilyloxymethoxy]silane.
| Compound Name | trimethyl-[methyl-[3-(oxiran-2-ylmethoxy)propyl]-trimethylsilyloxysilyl]oxysilane;trimethyl-[3-(oxiran-2-ylmethoxy)propylsilyl-trimethylsilyloxymethoxy]silane |
|---|---|
| PubChem CID | 160501197 |
| Molecular Formula | C26H64O8Si6 |
| Molecular Weight | 673.31 g/mol |
| Exact Mass | 672.32 |
| IUPAC Name | trimethyl-[methyl-[3-(oxiran-2-ylmethoxy)propyl]-trimethylsilyloxysilyl]oxysilane;trimethyl-[3-(oxiran-2-ylmethoxy)propylsilyl-trimethylsilyloxymethoxy]silane |
| SMILES | C[Si](C)(C)OC(O[Si](C)(C)C)[SiH2]CCCOCC1CO1.C[Si](C)(C)O[Si](C)(CCCOCC1CO1)O[Si](C)(C)C |
| InChI | InChI=1S/2C13H32O4Si3/c1-18(2,3)16-20(7,17-19(4,5)6)10-8-9-14-11-13-12-15-13;1-19(2,3)16-13(17-20(4,5)6)18-9-7-8-14-10-12-11-15-12/h13H,8-12H2,1-7H3;12-13H,7-11,18H2,1-6H3 |
| InChIKey | QRUPBDHIKBJPGY-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 80.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.31 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|