C18H42O5Si3 — CID 70660178
trimethyl-[methyl-[3-[3-(oxolan-2-ylmethoxy)propoxy]propyl]-trimethylsilyloxysilyl]oxysilane (PubChem CID 70660178) has the molecular formula C18H42O5Si3 and a molecular weight of 422.79 g/mol. Its IUPAC name is trimethyl-[methyl-[3-[3-(oxolan-2-ylmethoxy)propoxy]propyl]-trimethylsilyloxysilyl]oxysilane.
| Compound Name | trimethyl-[methyl-[3-[3-(oxolan-2-ylmethoxy)propoxy]propyl]-trimethylsilyloxysilyl]oxysilane |
|---|---|
| PubChem CID | 70660178 |
| Molecular Formula | C18H42O5Si3 |
| Molecular Weight | 422.79 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | trimethyl-[methyl-[3-[3-(oxolan-2-ylmethoxy)propoxy]propyl]-trimethylsilyloxysilyl]oxysilane |
| SMILES | C[Si](C)(C)O[Si](C)(CCCOCCCOCC1CCCO1)O[Si](C)(C)C |
| InChI | InChI=1S/C18H42O5Si3/c1-24(2,3)22-26(7,23-25(4,5)6)16-10-14-19-12-9-13-20-17-18-11-8-15-21-18/h18H,8-17H2,1-7H3 |
| InChIKey | DSDINCIQIPWKOB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.79 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|