C14H17BrO3 — CID 118056805
[(4S)-2-bromo-7-hydroxyhept-1-en-4-yl] benzoate (PubChem CID 118056805) has the molecular formula C14H17BrO3 and a molecular weight of 313.19 g/mol. Its IUPAC name is [(4S)-2-bromo-7-hydroxyhept-1-en-4-yl] benzoate.
| Compound Name | [(4S)-2-bromo-7-hydroxyhept-1-en-4-yl] benzoate |
|---|---|
| PubChem CID | 118056805 |
| Molecular Formula | C14H17BrO3 |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | [(4S)-2-bromo-7-hydroxyhept-1-en-4-yl] benzoate |
| SMILES | C=C(Br)C[C@H](CCCO)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H17BrO3/c1-11(15)10-13(8-5-9-16)18-14(17)12-6-3-2-4-7-12/h2-4,6-7,13,16H,1,5,8-10H2/t13-/m0/s1 |
| InChIKey | BEVOXAIVVWGHET-ZDUSSCGKSA-N |
| XLogP | 3.28 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |