C24H38O8 — CID 70212001
bis(1,8-dihydroxyoctan-2-yl) benzene-1,4-dicarboxylate (PubChem CID 70212001) has the molecular formula C24H38O8 and a molecular weight of 454.56 g/mol. Its IUPAC name is bis(1,8-dihydroxyoctan-2-yl) benzene-1,4-dicarboxylate.
| Compound Name | bis(1,8-dihydroxyoctan-2-yl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 70212001 |
| Molecular Formula | C24H38O8 |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | bis(1,8-dihydroxyoctan-2-yl) benzene-1,4-dicarboxylate |
| SMILES | O=C(OC(CO)CCCCCCO)c1ccc(C(=O)OC(CO)CCCCCCO)cc1 |
| InChI | InChI=1S/C24H38O8/c25-15-7-3-1-5-9-21(17-27)31-23(29)19-11-13-20(14-12-19)24(30)32-22(18-28)10-6-2-4-8-16-26/h11-14,21-22,25-28H,1-10,15-18H2 |
| InChIKey | MVYAZNLWBWAKMY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|