C20H26O6 — CID 118453641
4-[1,8-bis(ethenoxy)octan-4-yloxycarbonyl]benzoic acid (PubChem CID 118453641) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is 4-[1,8-bis(ethenoxy)octan-4-yloxycarbonyl]benzoic acid.
| Compound Name | 4-[1,8-bis(ethenoxy)octan-4-yloxycarbonyl]benzoic acid |
|---|---|
| PubChem CID | 118453641 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 4-[1,8-bis(ethenoxy)octan-4-yloxycarbonyl]benzoic acid |
| SMILES | C=COCCCCC(CCCOC=C)OC(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C20H26O6/c1-3-24-14-6-5-8-18(9-7-15-25-4-2)26-20(23)17-12-10-16(11-13-17)19(21)22/h3-4,10-13,18H,1-2,5-9,14-15H2,(H,21,22) |
| InChIKey | LZDQCNXEJXAKSE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|