C27H36O9 — CID 66897152
4-[1,9-bis(ethenoxy)-5-(3-ethenoxypropyl)nonan-5-yl]oxycarbonylbenzene-1,3-dicarboxylic acid (PubChem CID 66897152) has the molecular formula C27H36O9 and a molecular weight of 504.58 g/mol. Its IUPAC name is 4-[1,9-bis(ethenoxy)-5-(3-ethenoxypropyl)nonan-5-yl]oxycarbonylbenzene-1,3-dicarboxylic acid.
| Compound Name | 4-[1,9-bis(ethenoxy)-5-(3-ethenoxypropyl)nonan-5-yl]oxycarbonylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 66897152 |
| Molecular Formula | C27H36O9 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | 4-[1,9-bis(ethenoxy)-5-(3-ethenoxypropyl)nonan-5-yl]oxycarbonylbenzene-1,3-dicarboxylic acid |
| SMILES | C=COCCCCC(CCCCOC=C)(CCCOC=C)OC(=O)c1ccc(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C27H36O9/c1-4-33-17-9-7-14-27(16-11-19-35-6-3,15-8-10-18-34-5-2)36-26(32)22-13-12-21(24(28)29)20-23(22)25(30)31/h4-6,12-13,20H,1-3,7-11,14-19H2,(H,28,29)(H,30,31) |
| InChIKey | UZVVFWQBAGWUKN-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|