C34H42O10 — CID 130395115
[2-hydroxy-6-(2-methylprop-2-enoyloxy)hexyl] 4-[4-[1-hydroxy-6-(2-methylprop-2-enoyloxy)hexan-2-yl]oxycarbonylphenyl]benzoate (PubChem CID 130395115) has the molecular formula C34H42O10 and a molecular weight of 610.70 g/mol. Its IUPAC name is [2-hydroxy-6-(2-methylprop-2-enoyloxy)hexyl] 4-[4-[1-hydroxy-6-(2-methylprop-2-enoyloxy)hexan-2-yl]oxycarbonylphenyl]benzoate.
| Compound Name | [2-hydroxy-6-(2-methylprop-2-enoyloxy)hexyl] 4-[4-[1-hydroxy-6-(2-methylprop-2-enoyloxy)hexan-2-yl]oxycarbonylphenyl]benzoate |
|---|---|
| PubChem CID | 130395115 |
| Molecular Formula | C34H42O10 |
| Molecular Weight | 610.70 g/mol |
| Exact Mass | 610.28 |
| IUPAC Name | [2-hydroxy-6-(2-methylprop-2-enoyloxy)hexyl] 4-[4-[1-hydroxy-6-(2-methylprop-2-enoyloxy)hexan-2-yl]oxycarbonylphenyl]benzoate |
| SMILES | C=C(C)C(=O)OCCCCC(O)COC(=O)c1ccc(-c2ccc(C(=O)OC(CO)CCCCOC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C34H42O10/c1-23(2)31(37)41-19-7-5-9-29(36)22-43-33(39)27-15-11-25(12-16-27)26-13-17-28(18-14-26)34(40)44-30(21-35)10-6-8-20-42-32(38)24(3)4/h11-18,29-30,35-36H,1,3,5-10,19-22H2,2,4H3 |
| InChIKey | XGDVCXPBCDGMFW-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.70 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|