C27H35BrO9 — CID 144841308
[2-bromo-8-[(3S,4S,9R)-4,8-dihydroxy-11-(2-hydroxyethyl)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]-7-oxooct-1-en-4-yl] benzoate (PubChem CID 144841308) has the molecular formula C27H35BrO9 and a molecular weight of 583.47 g/mol. Its IUPAC name is [2-bromo-8-[(3S,4S,9R)-4,8-dihydroxy-11-(2-hydroxyethyl)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]-7-oxooct-1-en-4-yl] benzoate.
| Compound Name | [2-bromo-8-[(3S,4S,9R)-4,8-dihydroxy-11-(2-hydroxyethyl)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]-7-oxooct-1-en-4-yl] benzoate |
|---|---|
| PubChem CID | 144841308 |
| Molecular Formula | C27H35BrO9 |
| Molecular Weight | 583.47 g/mol |
| Exact Mass | 582.15 |
| IUPAC Name | [2-bromo-8-[(3S,4S,9R)-4,8-dihydroxy-11-(2-hydroxyethyl)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]-7-oxooct-1-en-4-yl] benzoate |
| SMILES | C=C(Br)CC(CCC(=O)CC1OC2C(O)[C@H]3OC(CCO)CCC3O[C@H]2[C@H]1O)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H35BrO9/c1-15(28)13-19(35-27(33)16-5-3-2-4-6-16)8-7-17(30)14-21-22(31)25-26(37-21)23(32)24-20(36-25)10-9-18(34-24)11-12-29/h2-6,18-26,29,31-32H,1,7-14H2/t18?,19?,20?,21?,22-,23?,24-,25-,26?/m0/s1 |
| InChIKey | GUCMNZWBHOHQLM-DHQZOHDYSA-N |
| XLogP | 2.44 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |