C16H22O5 — CID 134997296
tert-butyl (3S)-3-hydroxy-3-[(2S,3S)-3-phenylmethoxyoxiran-2-yl]propanoate (PubChem CID 134997296) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is tert-butyl (3S)-3-hydroxy-3-[(2S,3S)-3-phenylmethoxyoxiran-2-yl]propanoate.
| Compound Name | tert-butyl (3S)-3-hydroxy-3-[(2S,3S)-3-phenylmethoxyoxiran-2-yl]propanoate |
|---|---|
| PubChem CID | 134997296 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | tert-butyl (3S)-3-hydroxy-3-[(2S,3S)-3-phenylmethoxyoxiran-2-yl]propanoate |
| SMILES | CC(C)(C)OC(=O)C[C@H](O)[C@@H]1O[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C16H22O5/c1-16(2,3)21-13(18)9-12(17)14-15(20-14)19-10-11-7-5-4-6-8-11/h4-8,12,14-15,17H,9-10H2,1-3H3/t12-,14-,15-/m0/s1 |
| InChIKey | AQWSCEPXXLXUKK-QEJZJMRPSA-N |
| XLogP | 2.02 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|