C28H36O3S — CID 88643236
(5S,6R,7E,9E)-6-benzylsulfanyl-1-(oxan-2-yloxy)-10-phenyldeca-7,9-dien-5-ol (PubChem CID 88643236) has the molecular formula C28H36O3S and a molecular weight of 452.66 g/mol. Its IUPAC name is (5S,6R,7E,9E)-6-benzylsulfanyl-1-(oxan-2-yloxy)-10-phenyldeca-7,9-dien-5-ol.
| Compound Name | (5S,6R,7E,9E)-6-benzylsulfanyl-1-(oxan-2-yloxy)-10-phenyldeca-7,9-dien-5-ol |
|---|---|
| PubChem CID | 88643236 |
| Molecular Formula | C28H36O3S |
| Molecular Weight | 452.66 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | (5S,6R,7E,9E)-6-benzylsulfanyl-1-(oxan-2-yloxy)-10-phenyldeca-7,9-dien-5-ol |
| SMILES | O[C@@H](CCCCOC1CCCCO1)[C@@H](/C=C/C=C/c1ccccc1)SCc1ccccc1 |
| InChI | InChI=1S/C28H36O3S/c29-26(18-9-11-21-30-28-20-10-12-22-31-28)27(32-23-25-16-5-2-6-17-25)19-8-7-15-24-13-3-1-4-14-24/h1-8,13-17,19,26-29H,9-12,18,20-23H2/b15-7+,19-8+/t26-,27+,28?/m0/s1 |
| InChIKey | DOWDWHSXNUONTC-CPOFCLPDSA-N |
| XLogP | 6.63 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.66 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|