C34H44IO2P — CID 175312543
11-(oxan-2-yloxy)undec-4-enyl-triphenylphosphanium iodide (PubChem CID 175312543) has the molecular formula C34H44IO2P and a molecular weight of 642.60 g/mol. Its IUPAC name is 11-(oxan-2-yloxy)undec-4-enyl-triphenylphosphanium iodide.
| Compound Name | 11-(oxan-2-yloxy)undec-4-enyl-triphenylphosphanium iodide |
|---|---|
| PubChem CID | 175312543 |
| Molecular Formula | C34H44IO2P |
| Molecular Weight | 642.60 g/mol |
| Exact Mass | 642.21 |
| IUPAC Name | 11-(oxan-2-yloxy)undec-4-enyl-triphenylphosphanium iodide |
| SMILES | C(=CCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)CCCCCCOC1CCCCO1.[I-] |
| InChI | InChI=1S/C34H44O2P.HI/c1(2-4-6-18-28-35-34-27-17-19-29-36-34)3-5-7-20-30-37(31-21-11-8-12-22-31,32-23-13-9-14-24-32)33-25-15-10-16-26-33;/h3,5,8-16,21-26,34H,1-2,4,6-7,17-20,27-30H2;1H/q+1;/p-1 |
| InChIKey | CPHOCPBZEUUOBE-UHFFFAOYSA-M |
| XLogP | 4.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.60 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|