C28H39O3P — CID 12790960
2-[(Z)-11-diphenylphosphorylundec-7-enoxy]oxane (PubChem CID 12790960) has the molecular formula C28H39O3P and a molecular weight of 454.59 g/mol. Its IUPAC name is 2-[(Z)-11-diphenylphosphorylundec-7-enoxy]oxane.
| Compound Name | 2-[(Z)-11-diphenylphosphorylundec-7-enoxy]oxane |
|---|---|
| PubChem CID | 12790960 |
| Molecular Formula | C28H39O3P |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | 2-[(Z)-11-diphenylphosphorylundec-7-enoxy]oxane |
| SMILES | O=P(CCC/C=C\CCCCCCOC1CCCCO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H39O3P/c29-32(26-18-10-8-11-19-26,27-20-12-9-13-21-27)25-17-7-5-3-1-2-4-6-15-23-30-28-22-14-16-24-31-28/h3,5,8-13,18-21,28H,1-2,4,6-7,14-17,22-25H2/b5-3- |
| InChIKey | PFVVTRNQDCHSBL-HYXAFXHYSA-N |
| XLogP | 6.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|