About CID 10882542
CID 10882542 (PubChem CID 10882542) has the molecular formula C21H32O2Si
and a molecular weight of 344.57 g/mol.
Molecular Properties
| Compound Name | CID 10882542 |
| PubChem CID | 10882542 |
| Molecular Formula | C21H32O2Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | — |
| SMILES | CCC(C)/C=C(\CCCCOC1CCCCO1)[Si]c1ccccc1 |
| InChI | InChI=1S/C21H32O2Si/c1-3-18(2)17-20(24-19-11-5-4-6-12-19)13-7-9-15-22-21-14-8-10-16-23-21/h4-6,11-12,17-18,21H,3,7-10,13-16H2,1-2H3/b20-17+ |
| InChIKey | SXVABAXTCRAUCV-LVZFUZTISA-N |
| XLogP | 4.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 10882542 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10882542?
The IUPAC name of CID 10882542 (CID 10882542) is not available.
What is the SMILES notation for CID 10882542?
The canonical SMILES for CID 10882542 is CCC(C)/C=C(\CCCCOC1CCCCO1)[Si]c1ccccc1.
What is the InChIKey of CID 10882542?
The InChIKey is SXVABAXTCRAUCV-LVZFUZTISA-N. The full InChI is InChI=1S/C21H32O2Si/c1-3-18(2)17-20(24-19-11-5-4-6-12-19)13-7-9-15-22-21-14-8-10-16-23-21/h4-6,11-12,17-18,21H,3,7-10,13-16H2,1-2H3/b20-17+.
What are the key properties of CID 10882542?
CID 10882542 has a molecular weight of 344.57 g/mol, XLogP of 4.66, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10882542 is sourced from PubChem (CID 10882542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).