C24H33NO4Si — CID 10550433
ethyl (2R,3R)-2-[dimethyl(phenyl)silyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate (PubChem CID 10550433) has the molecular formula C24H33NO4Si and a molecular weight of 427.62 g/mol. Its IUPAC name is ethyl (2R,3R)-2-[dimethyl(phenyl)silyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate.
| Compound Name | ethyl (2R,3R)-2-[dimethyl(phenyl)silyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 10550433 |
| Molecular Formula | C24H33NO4Si |
| Molecular Weight | 427.62 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | ethyl (2R,3R)-2-[dimethyl(phenyl)silyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate |
| SMILES | CCOC(=O)[C@@H]([C@H](NC(=O)OC(C)(C)C)c1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C24H33NO4Si/c1-7-28-22(26)21(30(5,6)19-16-12-9-13-17-19)20(18-14-10-8-11-15-18)25-23(27)29-24(2,3)4/h8-17,20-21H,7H2,1-6H3,(H,25,27)/t20-,21-/m1/s1 |
| InChIKey | LBWZTQZSNSHXAL-NHCUHLMSSA-N |
| XLogP | 4.80 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.62 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|