C20H29NO5 — CID 44597263
ethyl (E,5S,6S)-5-(hydroxymethyl)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylhex-2-enoate (PubChem CID 44597263) has the molecular formula C20H29NO5 and a molecular weight of 363.45 g/mol. Its IUPAC name is ethyl (E,5S,6S)-5-(hydroxymethyl)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylhex-2-enoate.
| Compound Name | ethyl (E,5S,6S)-5-(hydroxymethyl)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylhex-2-enoate |
|---|---|
| PubChem CID | 44597263 |
| Molecular Formula | C20H29NO5 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | ethyl (E,5S,6S)-5-(hydroxymethyl)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylhex-2-enoate |
| SMILES | CCOC(=O)/C=C/C[C@H](CO)[C@H](NC(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C20H29NO5/c1-5-25-17(23)13-9-12-16(14-22)18(15-10-7-6-8-11-15)21-19(24)26-20(2,3)4/h6-11,13,16,18,22H,5,12,14H2,1-4H3,(H,21,24)/b13-9+/t16-,18-/m1/s1 |
| InChIKey | NMJQIQGLCMFSHW-KQHUNKBVSA-N |
| XLogP | 3.37 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|