C9H14INO4 — CID 155763657
tert-butyl N-(1-iodo-3,4-dioxobutan-2-yl)carbamate (PubChem CID 155763657) has the molecular formula C9H14INO4 and a molecular weight of 327.12 g/mol. Its IUPAC name is tert-butyl N-(1-iodo-3,4-dioxobutan-2-yl)carbamate.
| Compound Name | tert-butyl N-(1-iodo-3,4-dioxobutan-2-yl)carbamate |
|---|---|
| PubChem CID | 155763657 |
| Molecular Formula | C9H14INO4 |
| Molecular Weight | 327.12 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | tert-butyl N-(1-iodo-3,4-dioxobutan-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CI)C(=O)C=O |
| InChI | InChI=1S/C9H14INO4/c1-9(2,3)15-8(14)11-6(4-10)7(13)5-12/h5-6H,4H2,1-3H3,(H,11,14) |
| InChIKey | YLFYPQKCJBAWQB-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.12 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|