C18H32N2O7 — CID 164524876
tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(prop-2-enoxycarbonylamino)oxypentanoate (PubChem CID 164524876) has the molecular formula C18H32N2O7 and a molecular weight of 388.46 g/mol. Its IUPAC name is tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(prop-2-enoxycarbonylamino)oxypentanoate.
| Compound Name | tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(prop-2-enoxycarbonylamino)oxypentanoate |
|---|---|
| PubChem CID | 164524876 |
| Molecular Formula | C18H32N2O7 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(prop-2-enoxycarbonylamino)oxypentanoate |
| SMILES | C=CCOC(=O)NOCCCC(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H32N2O7/c1-8-11-24-16(23)20-25-12-9-10-13(14(21)26-17(2,3)4)19-15(22)27-18(5,6)7/h8,13H,1,9-12H2,2-7H3,(H,19,22)(H,20,23) |
| InChIKey | GPMYBUHRGRKSOM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|