C14H21BrCl3NO5 — CID 122589469
2,2,2-trichloroethyl (2R)-7-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxoheptanoate (PubChem CID 122589469) has the molecular formula C14H21BrCl3NO5 and a molecular weight of 469.59 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (2R)-7-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxoheptanoate.
| Compound Name | 2,2,2-trichloroethyl (2R)-7-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxoheptanoate |
|---|---|
| PubChem CID | 122589469 |
| Molecular Formula | C14H21BrCl3NO5 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 466.97 |
| IUPAC Name | 2,2,2-trichloroethyl (2R)-7-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxoheptanoate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCCC(=O)CBr)C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H21BrCl3NO5/c1-13(2,3)24-12(22)19-10(6-4-5-9(20)7-15)11(21)23-8-14(16,17)18/h10H,4-8H2,1-3H3,(H,19,22)/t10-/m1/s1 |
| InChIKey | ARUSTGYMYLHKTC-SNVBAGLBSA-N |
| XLogP | 3.93 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|