C14H25KN2O5 — CID 118533382
potassium (2S)-6-amino-2-(7-carboxyheptanoylamino)hexanoate (PubChem CID 118533382) has the molecular formula C14H25KN2O5 and a molecular weight of 340.46 g/mol. Its IUPAC name is potassium (2S)-6-amino-2-(7-carboxyheptanoylamino)hexanoate.
| Compound Name | potassium (2S)-6-amino-2-(7-carboxyheptanoylamino)hexanoate |
|---|---|
| PubChem CID | 118533382 |
| Molecular Formula | C14H25KN2O5 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | potassium (2S)-6-amino-2-(7-carboxyheptanoylamino)hexanoate |
| SMILES | NCCCC[C@H](NC(=O)CCCCCCC(=O)O)C(=O)[O-].[K+] |
| InChI | InChI=1S/C14H26N2O5.K/c15-10-6-5-7-11(14(20)21)16-12(17)8-3-1-2-4-9-13(18)19;/h11H,1-10,15H2,(H,16,17)(H,18,19)(H,20,21);/q;+1/p-1/t11-;/m0./s1 |
| InChIKey | RSPGMJLBAKTWGO-MERQFXBCSA-M |
| XLogP | -3.22 |
| TPSA | 132.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|