C12H24N3O5P — CID 162820848
2-[2-[(2-amino-4-dimethylphosphorylbutanoyl)amino]propanoylamino]propanoic acid (PubChem CID 162820848) has the molecular formula C12H24N3O5P and a molecular weight of 321.31 g/mol. Its IUPAC name is 2-[2-[(2-amino-4-dimethylphosphorylbutanoyl)amino]propanoylamino]propanoic acid.
| Compound Name | 2-[2-[(2-amino-4-dimethylphosphorylbutanoyl)amino]propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 162820848 |
| Molecular Formula | C12H24N3O5P |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 2-[2-[(2-amino-4-dimethylphosphorylbutanoyl)amino]propanoylamino]propanoic acid |
| SMILES | CC(NC(=O)C(C)NC(=O)C(N)CCP(C)(C)=O)C(=O)O |
| InChI | InChI=1S/C12H24N3O5P/c1-7(10(16)15-8(2)12(18)19)14-11(17)9(13)5-6-21(3,4)20/h7-9H,5-6,13H2,1-4H3,(H,14,17)(H,15,16)(H,18,19) |
| InChIKey | YGNXEZOPSLBXAG-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|