C20H22N2O3S2 — CID 87020519
N-[2-(1-benzothiophen-3-yl)ethyl]-5-(ethylsulfamoyl)-2-methylbenzamide (PubChem CID 87020519) has the molecular formula C20H22N2O3S2 and a molecular weight of 402.54 g/mol. Its IUPAC name is N-[2-(1-benzothiophen-3-yl)ethyl]-5-(ethylsulfamoyl)-2-methylbenzamide.
| Compound Name | N-[2-(1-benzothiophen-3-yl)ethyl]-5-(ethylsulfamoyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 87020519 |
| Molecular Formula | C20H22N2O3S2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | N-[2-(1-benzothiophen-3-yl)ethyl]-5-(ethylsulfamoyl)-2-methylbenzamide |
| SMILES | CCNS(=O)(=O)c1ccc(C)c(C(=O)NCCc2csc3ccccc23)c1 |
| InChI | InChI=1S/C20H22N2O3S2/c1-3-22-27(24,25)16-9-8-14(2)18(12-16)20(23)21-11-10-15-13-26-19-7-5-4-6-17(15)19/h4-9,12-13,22H,3,10-11H2,1-2H3,(H,21,23) |
| InChIKey | UHLHPIIGSQWEPT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |