C13H16N2OS — CID 116847650
3-(1-benzothiophen-3-yl)-N',N'-dimethylpropanehydrazide (PubChem CID 116847650) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is 3-(1-benzothiophen-3-yl)-N',N'-dimethylpropanehydrazide.
| Compound Name | 3-(1-benzothiophen-3-yl)-N',N'-dimethylpropanehydrazide |
|---|---|
| PubChem CID | 116847650 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 3-(1-benzothiophen-3-yl)-N',N'-dimethylpropanehydrazide |
| SMILES | CN(C)NC(=O)CCc1csc2ccccc12 |
| InChI | InChI=1S/C13H16N2OS/c1-15(2)14-13(16)8-7-10-9-17-12-6-4-3-5-11(10)12/h3-6,9H,7-8H2,1-2H3,(H,14,16) |
| InChIKey | GKGOLIHCXSCTGK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|