C13H17N3OS — CID 116850079
3-amino-3-(1-benzothiophen-3-yl)-N',N'-dimethylpropanehydrazide (PubChem CID 116850079) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is 3-amino-3-(1-benzothiophen-3-yl)-N',N'-dimethylpropanehydrazide.
| Compound Name | 3-amino-3-(1-benzothiophen-3-yl)-N',N'-dimethylpropanehydrazide |
|---|---|
| PubChem CID | 116850079 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 3-amino-3-(1-benzothiophen-3-yl)-N',N'-dimethylpropanehydrazide |
| SMILES | CN(C)NC(=O)CC(N)c1csc2ccccc12 |
| InChI | InChI=1S/C13H17N3OS/c1-16(2)15-13(17)7-11(14)10-8-18-12-6-4-3-5-9(10)12/h3-6,8,11H,7,14H2,1-2H3,(H,15,17) |
| InChIKey | JBOYXLFUCNYVSS-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|