C12H15N3OS — CID 116849870
2-amino-2-(1-benzothiophen-3-yl)-N',N'-dimethylacetohydrazide (PubChem CID 116849870) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is 2-amino-2-(1-benzothiophen-3-yl)-N',N'-dimethylacetohydrazide.
| Compound Name | 2-amino-2-(1-benzothiophen-3-yl)-N',N'-dimethylacetohydrazide |
|---|---|
| PubChem CID | 116849870 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 2-amino-2-(1-benzothiophen-3-yl)-N',N'-dimethylacetohydrazide |
| SMILES | CN(C)NC(=O)C(N)c1csc2ccccc12 |
| InChI | InChI=1S/C12H15N3OS/c1-15(2)14-12(16)11(13)9-7-17-10-6-4-3-5-8(9)10/h3-7,11H,13H2,1-2H3,(H,14,16) |
| InChIKey | PIRGTSDSURVYEX-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|