C14H17NO2S — CID 143382265
methyl (2R,3S)-3-(1-benzothiophen-3-yl)-2-(methylamino)butanoate (PubChem CID 143382265) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is methyl (2R,3S)-3-(1-benzothiophen-3-yl)-2-(methylamino)butanoate.
| Compound Name | methyl (2R,3S)-3-(1-benzothiophen-3-yl)-2-(methylamino)butanoate |
|---|---|
| PubChem CID | 143382265 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | methyl (2R,3S)-3-(1-benzothiophen-3-yl)-2-(methylamino)butanoate |
| SMILES | CN[C@@H](C(=O)OC)[C@@H](C)c1csc2ccccc12 |
| InChI | InChI=1S/C14H17NO2S/c1-9(13(15-2)14(16)17-3)11-8-18-12-7-5-4-6-10(11)12/h4-9,13,15H,1-3H3/t9-,13+/m0/s1 |
| InChIKey | AVCFMBZFFRIMHB-TVQRCGJNSA-N |
| XLogP | 2.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |