C20H21N3O2S — CID 69487131
(2R)-2-[2-[3-(1-benzothiophen-3-yl)propanoyl]hydrazinyl]-3-phenylpropanamide (PubChem CID 69487131) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is (2R)-2-[2-[3-(1-benzothiophen-3-yl)propanoyl]hydrazinyl]-3-phenylpropanamide.
| Compound Name | (2R)-2-[2-[3-(1-benzothiophen-3-yl)propanoyl]hydrazinyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 69487131 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (2R)-2-[2-[3-(1-benzothiophen-3-yl)propanoyl]hydrazinyl]-3-phenylpropanamide |
| SMILES | NC(=O)[C@@H](Cc1ccccc1)NNC(=O)CCc1csc2ccccc12 |
| InChI | InChI=1S/C20H21N3O2S/c21-20(25)17(12-14-6-2-1-3-7-14)22-23-19(24)11-10-15-13-26-18-9-5-4-8-16(15)18/h1-9,13,17,22H,10-12H2,(H2,21,25)(H,23,24)/t17-/m1/s1 |
| InChIKey | WCHVZHPKTNWXPU-QGZVFWFLSA-N |
| XLogP | 2.55 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|