C18H16O3S — CID 23082921
3-[4-(1-benzothiophen-3-ylmethoxy)phenyl]propanoic acid (PubChem CID 23082921) has the molecular formula C18H16O3S and a molecular weight of 312.39 g/mol. Its IUPAC name is 3-[4-(1-benzothiophen-3-ylmethoxy)phenyl]propanoic acid.
| Compound Name | 3-[4-(1-benzothiophen-3-ylmethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 23082921 |
| Molecular Formula | C18H16O3S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 3-[4-(1-benzothiophen-3-ylmethoxy)phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(OCc2csc3ccccc23)cc1 |
| InChI | InChI=1S/C18H16O3S/c19-18(20)10-7-13-5-8-15(9-6-13)21-11-14-12-22-17-4-2-1-3-16(14)17/h1-6,8-9,12H,7,10-11H2,(H,19,20) |
| InChIKey | GYNPKHZYFHSDSZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |