C25H22O3S — CID 23159874
methyl 3-[4-[[3-(1-benzothiophen-3-yl)phenyl]methoxy]phenyl]propanoate (PubChem CID 23159874) has the molecular formula C25H22O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is methyl 3-[4-[[3-(1-benzothiophen-3-yl)phenyl]methoxy]phenyl]propanoate.
| Compound Name | methyl 3-[4-[[3-(1-benzothiophen-3-yl)phenyl]methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 23159874 |
| Molecular Formula | C25H22O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | methyl 3-[4-[[3-(1-benzothiophen-3-yl)phenyl]methoxy]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(OCc2cccc(-c3csc4ccccc34)c2)cc1 |
| InChI | InChI=1S/C25H22O3S/c1-27-25(26)14-11-18-9-12-21(13-10-18)28-16-19-5-4-6-20(15-19)23-17-29-24-8-3-2-7-22(23)24/h2-10,12-13,15,17H,11,14,16H2,1H3 |
| InChIKey | YXGSRFPKCJKCAS-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |