C24H23FO3 — CID 58903192
methyl 3-[4-[[3-(4-fluoro-2-methylphenyl)phenyl]methoxy]phenyl]propanoate (PubChem CID 58903192) has the molecular formula C24H23FO3 and a molecular weight of 378.44 g/mol. Its IUPAC name is methyl 3-[4-[[3-(4-fluoro-2-methylphenyl)phenyl]methoxy]phenyl]propanoate.
| Compound Name | methyl 3-[4-[[3-(4-fluoro-2-methylphenyl)phenyl]methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 58903192 |
| Molecular Formula | C24H23FO3 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | methyl 3-[4-[[3-(4-fluoro-2-methylphenyl)phenyl]methoxy]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(OCc2cccc(-c3ccc(F)cc3C)c2)cc1 |
| InChI | InChI=1S/C24H23FO3/c1-17-14-21(25)9-12-23(17)20-5-3-4-19(15-20)16-28-22-10-6-18(7-11-22)8-13-24(26)27-2/h3-7,9-12,14-15H,8,13,16H2,1-2H3 |
| InChIKey | OFCSMPGWHVXWQT-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |