C32H33NO4 — CID 58903135
methyl 3-[4-[[3-[2-methyl-4-(3-pyridin-2-ylpropoxy)phenyl]phenyl]methoxy]phenyl]propanoate (PubChem CID 58903135) has the molecular formula C32H33NO4 and a molecular weight of 495.62 g/mol. Its IUPAC name is methyl 3-[4-[[3-[2-methyl-4-(3-pyridin-2-ylpropoxy)phenyl]phenyl]methoxy]phenyl]propanoate.
| Compound Name | methyl 3-[4-[[3-[2-methyl-4-(3-pyridin-2-ylpropoxy)phenyl]phenyl]methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 58903135 |
| Molecular Formula | C32H33NO4 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | methyl 3-[4-[[3-[2-methyl-4-(3-pyridin-2-ylpropoxy)phenyl]phenyl]methoxy]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(OCc2cccc(-c3ccc(OCCCc4ccccn4)cc3C)c2)cc1 |
| InChI | InChI=1S/C32H33NO4/c1-24-21-30(36-20-6-10-28-9-3-4-19-33-28)16-17-31(24)27-8-5-7-26(22-27)23-37-29-14-11-25(12-15-29)13-18-32(34)35-2/h3-5,7-9,11-12,14-17,19,21-22H,6,10,13,18,20,23H2,1-2H3 |
| InChIKey | WWZXDQMLKOEHSI-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|