C24H22 — CID 174116925
1-[(2E,4E)-5-(4-methylphenyl)hepta-2,4,6-trien-2-yl]azulene (PubChem CID 174116925) has the molecular formula C24H22 and a molecular weight of 310.44 g/mol. Its IUPAC name is 1-[(2E,4E)-5-(4-methylphenyl)hepta-2,4,6-trien-2-yl]azulene.
| Compound Name | 1-[(2E,4E)-5-(4-methylphenyl)hepta-2,4,6-trien-2-yl]azulene |
|---|---|
| PubChem CID | 174116925 |
| Molecular Formula | C24H22 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 1-[(2E,4E)-5-(4-methylphenyl)hepta-2,4,6-trien-2-yl]azulene |
| SMILES | C=C/C(=C\C=C(/C)c1ccc2cccccc1-2)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H22/c1-4-20(21-13-10-18(2)11-14-21)15-12-19(3)23-17-16-22-8-6-5-7-9-24(22)23/h4-17H,1H2,2-3H3/b19-12+,20-15+ |
| InChIKey | BFIAGIJJQLMRQE-IRVPIMSSSA-N |
| XLogP | 6.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|