C19H20P2 — CID 138565562
[4-[(1E,3E)-1-ethenyl-4-(4-phosphanylphenyl)penta-1,3-dienyl]phenyl]phosphane (PubChem CID 138565562) has the molecular formula C19H20P2 and a molecular weight of 310.32 g/mol. Its IUPAC name is [4-[(1E,3E)-1-ethenyl-4-(4-phosphanylphenyl)penta-1,3-dienyl]phenyl]phosphane.
| Compound Name | [4-[(1E,3E)-1-ethenyl-4-(4-phosphanylphenyl)penta-1,3-dienyl]phenyl]phosphane |
|---|---|
| PubChem CID | 138565562 |
| Molecular Formula | C19H20P2 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | [4-[(1E,3E)-1-ethenyl-4-(4-phosphanylphenyl)penta-1,3-dienyl]phenyl]phosphane |
| SMILES | C=C/C(=C\C=C(/C)c1ccc(P)cc1)c1ccc(P)cc1 |
| InChI | InChI=1S/C19H20P2/c1-3-15(17-8-12-19(21)13-9-17)5-4-14(2)16-6-10-18(20)11-7-16/h3-13H,1,20-21H2,2H3/b14-4+,15-5+ |
| InChIKey | SAVFGFXNQPWHDZ-VHUAAIQRSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|