C36H33N3 — CID 139475333
2-(4-buta-1,3-dien-2-ylphenyl)-4-[4-[(2E,4Z)-hexa-2,4-dien-2-yl]phenyl]-6-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-1,3,5-triazine (PubChem CID 139475333) has the molecular formula C36H33N3 and a molecular weight of 507.68 g/mol. Its IUPAC name is 2-(4-buta-1,3-dien-2-ylphenyl)-4-[4-[(2E,4Z)-hexa-2,4-dien-2-yl]phenyl]-6-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-1,3,5-triazine.
| Compound Name | 2-(4-buta-1,3-dien-2-ylphenyl)-4-[4-[(2E,4Z)-hexa-2,4-dien-2-yl]phenyl]-6-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 139475333 |
| Molecular Formula | C36H33N3 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | 2-(4-buta-1,3-dien-2-ylphenyl)-4-[4-[(2E,4Z)-hexa-2,4-dien-2-yl]phenyl]-6-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-1,3,5-triazine |
| SMILES | C=CC(=C)c1ccc(-c2nc(-c3ccc(/C(C)=C/C=C\C)cc3)nc(-c3ccc(/C(C=C)=C/C)cc3)n2)cc1 |
| InChI | InChI=1S/C36H33N3/c1-7-11-12-26(6)29-15-21-32(22-16-29)35-37-34(31-19-13-28(14-20-31)25(5)8-2)38-36(39-35)33-23-17-30(18-24-33)27(9-3)10-4/h7-24H,2-3,5H2,1,4,6H3/b11-7-,26-12+,27-10+ |
| InChIKey | PYBMKKGWTBQYNB-UFAYFXDBSA-N |
| XLogP | 9.64 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|