C48H35N5 — CID 142607132
8-[4-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]-11,11-diphenylindolo[1,2-a]benzimidazole (PubChem CID 142607132) has the molecular formula C48H35N5 and a molecular weight of 681.84 g/mol. Its IUPAC name is 8-[4-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]-11,11-diphenylindolo[1,2-a]benzimidazole.
| Compound Name | 8-[4-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]-11,11-diphenylindolo[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 142607132 |
| Molecular Formula | C48H35N5 |
| Molecular Weight | 681.84 g/mol |
| Exact Mass | 681.29 |
| IUPAC Name | 8-[4-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]-11,11-diphenylindolo[1,2-a]benzimidazole |
| SMILES | C=C/C(=C\C=C/C)c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)nc3n4-c4ccccc4C3(c3ccccc3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C48H35N5/c1-3-5-17-33(4-2)34-26-28-36(29-27-34)45-50-44(35-18-9-6-10-19-35)51-46(52-45)37-30-31-43-41(32-37)49-47-48(38-20-11-7-12-21-38,39-22-13-8-14-23-39)40-24-15-16-25-42(40)53(43)47/h3-32H,2H2,1H3/b5-3-,33-17+ |
| InChIKey | BXANLRFDDYESMH-CYICIQIWSA-N |
| XLogP | 11.05 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.84 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|