C38H33N3 — CID 139475830
2-(4-buta-1,3-dien-2-ylphenyl)-4-[4-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]phenyl]-6-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-1,3,5-triazine (PubChem CID 139475830) has the molecular formula C38H33N3 and a molecular weight of 531.70 g/mol. Its IUPAC name is 2-(4-buta-1,3-dien-2-ylphenyl)-4-[4-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]phenyl]-6-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-1,3,5-triazine.
| Compound Name | 2-(4-buta-1,3-dien-2-ylphenyl)-4-[4-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]phenyl]-6-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 139475830 |
| Molecular Formula | C38H33N3 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | 2-(4-buta-1,3-dien-2-ylphenyl)-4-[4-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]phenyl]-6-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-1,3,5-triazine |
| SMILES | C=C/C=C\C=C(/C=C)c1ccc(-c2nc(-c3ccc(C(=C)C=C)cc3)nc(-c3ccc(/C(C=C)=C/C)cc3)n2)cc1 |
| InChI | InChI=1S/C38H33N3/c1-7-12-13-14-29(11-5)32-19-25-35(26-20-32)38-40-36(33-21-15-30(16-22-33)27(6)8-2)39-37(41-38)34-23-17-31(18-24-34)28(9-3)10-4/h7-26H,1-3,5-6H2,4H3/b13-12-,28-10+,29-14+ |
| InChIKey | JQFQGKLCVSZLHG-RIHOZRBSSA-N |
| XLogP | 9.97 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|