C27H29N3 — CID 118439109
3-(4-buta-1,3-dien-2-ylphenyl)-4-[(1E,3Z)-hexa-1,3,5-trienyl]-5-[(3E,5E)-7-methylocta-1,3,5-trien-3-yl]-1,2,4-triazole (PubChem CID 118439109) has the molecular formula C27H29N3 and a molecular weight of 395.55 g/mol. Its IUPAC name is 3-(4-buta-1,3-dien-2-ylphenyl)-4-[(1E,3Z)-hexa-1,3,5-trienyl]-5-[(3E,5E)-7-methylocta-1,3,5-trien-3-yl]-1,2,4-triazole.
| Compound Name | 3-(4-buta-1,3-dien-2-ylphenyl)-4-[(1E,3Z)-hexa-1,3,5-trienyl]-5-[(3E,5E)-7-methylocta-1,3,5-trien-3-yl]-1,2,4-triazole |
|---|---|
| PubChem CID | 118439109 |
| Molecular Formula | C27H29N3 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 3-(4-buta-1,3-dien-2-ylphenyl)-4-[(1E,3Z)-hexa-1,3,5-trienyl]-5-[(3E,5E)-7-methylocta-1,3,5-trien-3-yl]-1,2,4-triazole |
| SMILES | C=C/C=C\C=C\n1c(/C(C=C)=C/C=C/C(C)C)nnc1-c1ccc(C(=C)C=C)cc1 |
| InChI | InChI=1S/C27H29N3/c1-7-10-11-12-20-30-26(23(9-3)15-13-14-21(4)5)28-29-27(30)25-18-16-24(17-19-25)22(6)8-2/h7-21H,1-3,6H2,4-5H3/b11-10-,14-13+,20-12+,23-15+ |
| InChIKey | QLNQEAJWMWANGB-PPUQNVKISA-N |
| XLogP | 7.14 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|