C26H18O2S2 — CID 67087616
[2,6-bis(1-benzothiophen-3-yl)-4-methylphenyl] prop-2-enoate (PubChem CID 67087616) has the molecular formula C26H18O2S2 and a molecular weight of 426.56 g/mol. Its IUPAC name is [2,6-bis(1-benzothiophen-3-yl)-4-methylphenyl] prop-2-enoate.
| Compound Name | [2,6-bis(1-benzothiophen-3-yl)-4-methylphenyl] prop-2-enoate |
|---|---|
| PubChem CID | 67087616 |
| Molecular Formula | C26H18O2S2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | [2,6-bis(1-benzothiophen-3-yl)-4-methylphenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1c(-c2csc3ccccc23)cc(C)cc1-c1csc2ccccc12 |
| InChI | InChI=1S/C26H18O2S2/c1-3-25(27)28-26-19(21-14-29-23-10-6-4-8-17(21)23)12-16(2)13-20(26)22-15-30-24-11-7-5-9-18(22)24/h3-15H,1H2,2H3 |
| InChIKey | SJZYRPHCZOUCSZ-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|