C27H20O2S2 — CID 67087502
[2,6-bis(2-benzothiophen-1-yl)-4-methylphenyl] 2-methylprop-2-enoate (PubChem CID 67087502) has the molecular formula C27H20O2S2 and a molecular weight of 440.59 g/mol. Its IUPAC name is [2,6-bis(2-benzothiophen-1-yl)-4-methylphenyl] 2-methylprop-2-enoate.
| Compound Name | [2,6-bis(2-benzothiophen-1-yl)-4-methylphenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 67087502 |
| Molecular Formula | C27H20O2S2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | [2,6-bis(2-benzothiophen-1-yl)-4-methylphenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1c(-c2scc3ccccc23)cc(C)cc1-c1scc2ccccc12 |
| InChI | InChI=1S/C27H20O2S2/c1-16(2)27(28)29-24-22(25-20-10-6-4-8-18(20)14-30-25)12-17(3)13-23(24)26-21-11-7-5-9-19(21)15-31-26/h4-15H,1H2,2-3H3 |
| InChIKey | SSSYQCYUUHDHEA-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|