C22H22O4 — CID 170928665
[(1E,3E)-4-[(4R)-4-methylcyclohexa-1,5-diene-1-carbonyl]oxyhexa-1,3,5-trienyl] 4-methylbenzoate (PubChem CID 170928665) has the molecular formula C22H22O4 and a molecular weight of 350.41 g/mol. Its IUPAC name is [(1E,3E)-4-[(4R)-4-methylcyclohexa-1,5-diene-1-carbonyl]oxyhexa-1,3,5-trienyl] 4-methylbenzoate.
| Compound Name | [(1E,3E)-4-[(4R)-4-methylcyclohexa-1,5-diene-1-carbonyl]oxyhexa-1,3,5-trienyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 170928665 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | [(1E,3E)-4-[(4R)-4-methylcyclohexa-1,5-diene-1-carbonyl]oxyhexa-1,3,5-trienyl] 4-methylbenzoate |
| SMILES | C=C/C(=C\C=C\OC(=O)c1ccc(C)cc1)OC(=O)C1=CC[C@@H](C)C=C1 |
| InChI | InChI=1S/C22H22O4/c1-4-20(26-22(24)19-13-9-17(3)10-14-19)6-5-15-25-21(23)18-11-7-16(2)8-12-18/h4-9,11-15,17H,1,10H2,2-3H3/b15-5+,20-6+/t17-/m0/s1 |
| InChIKey | TWKYTIODFCVFFJ-REICYWEFSA-N |
| XLogP | 4.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|