C21H22O3 — CID 163854210
[4-[(1E,3E)-4-methoxyhexa-1,3,5-trienoxy]cyclohexa-2,4-dien-1-yl]-(4-methylphenyl)methanone (PubChem CID 163854210) has the molecular formula C21H22O3 and a molecular weight of 322.40 g/mol. Its IUPAC name is [4-[(1E,3E)-4-methoxyhexa-1,3,5-trienoxy]cyclohexa-2,4-dien-1-yl]-(4-methylphenyl)methanone.
| Compound Name | [4-[(1E,3E)-4-methoxyhexa-1,3,5-trienoxy]cyclohexa-2,4-dien-1-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 163854210 |
| Molecular Formula | C21H22O3 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | [4-[(1E,3E)-4-methoxyhexa-1,3,5-trienoxy]cyclohexa-2,4-dien-1-yl]-(4-methylphenyl)methanone |
| SMILES | C=C/C(=C\C=C\OC1=CCC(C(=O)c2ccc(C)cc2)C=C1)OC |
| InChI | InChI=1S/C21H22O3/c1-4-19(23-3)6-5-15-24-20-13-11-18(12-14-20)21(22)17-9-7-16(2)8-10-17/h4-11,13-15,18H,1,12H2,2-3H3/b15-5+,19-6+ |
| InChIKey | OWXRLMFBKANDEU-DSINDEJCSA-N |
| XLogP | 4.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|