C21H28N6O4 — CID 46471859
N,N-diethyl-4-[[(4-hydroxy-1-phenylpyrazole-3-carbonyl)amino]carbamoyl]piperidine-1-carboxamide (PubChem CID 46471859) has the molecular formula C21H28N6O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is N,N-diethyl-4-[[(4-hydroxy-1-phenylpyrazole-3-carbonyl)amino]carbamoyl]piperidine-1-carboxamide.
| Compound Name | N,N-diethyl-4-[[(4-hydroxy-1-phenylpyrazole-3-carbonyl)amino]carbamoyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 46471859 |
| Molecular Formula | C21H28N6O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | N,N-diethyl-4-[[(4-hydroxy-1-phenylpyrazole-3-carbonyl)amino]carbamoyl]piperidine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCC(C(=O)NNC(=O)c2nn(-c3ccccc3)cc2O)CC1 |
| InChI | InChI=1S/C21H28N6O4/c1-3-25(4-2)21(31)26-12-10-15(11-13-26)19(29)22-23-20(30)18-17(28)14-27(24-18)16-8-6-5-7-9-16/h5-9,14-15,28H,3-4,10-13H2,1-2H3,(H,22,29)(H,23,30) |
| InChIKey | GXFUUQSJVVFZPH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|