C17H14N6O5 — CID 46657614
N'-(4-amino-3-nitrobenzoyl)-4-hydroxy-1-phenylpyrazole-3-carbohydrazide (PubChem CID 46657614) has the molecular formula C17H14N6O5 and a molecular weight of 382.34 g/mol. Its IUPAC name is N'-(4-amino-3-nitrobenzoyl)-4-hydroxy-1-phenylpyrazole-3-carbohydrazide.
| Compound Name | N'-(4-amino-3-nitrobenzoyl)-4-hydroxy-1-phenylpyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 46657614 |
| Molecular Formula | C17H14N6O5 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N'-(4-amino-3-nitrobenzoyl)-4-hydroxy-1-phenylpyrazole-3-carbohydrazide |
| SMILES | Nc1ccc(C(=O)NNC(=O)c2nn(-c3ccccc3)cc2O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14N6O5/c18-12-7-6-10(8-13(12)23(27)28)16(25)19-20-17(26)15-14(24)9-22(21-15)11-4-2-1-3-5-11/h1-9,24H,18H2,(H,19,25)(H,20,26) |
| InChIKey | VMLCLRIFVPYCBW-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 165.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|