C24H21N5O3 — CID 2369310
N-[[3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]pyridine-4-carboxamide (PubChem CID 2369310) has the molecular formula C24H21N5O3 and a molecular weight of 427.46 g/mol. Its IUPAC name is N-[[3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[[3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 2369310 |
| Molecular Formula | C24H21N5O3 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | N-[[3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]pyridine-4-carboxamide |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2C=NNC(=O)c2ccncc2)cc1OC |
| InChI | InChI=1S/C24H21N5O3/c1-31-21-9-8-18(14-22(21)32-2)23-19(16-29(28-23)20-6-4-3-5-7-20)15-26-27-24(30)17-10-12-25-13-11-17/h3-16H,1-2H3,(H,27,30) |
| InChIKey | VZIJHWCUVBOYCG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|