C23H24FN5OS — CID 26030593
1-(2,3-dimethylphenyl)-3-[[1-(4-fluorophenyl)-4,5,6,7-tetrahydroindazole-3-carbonyl]amino]thiourea (PubChem CID 26030593) has the molecular formula C23H24FN5OS and a molecular weight of 437.54 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-[[1-(4-fluorophenyl)-4,5,6,7-tetrahydroindazole-3-carbonyl]amino]thiourea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-[[1-(4-fluorophenyl)-4,5,6,7-tetrahydroindazole-3-carbonyl]amino]thiourea |
|---|---|
| PubChem CID | 26030593 |
| Molecular Formula | C23H24FN5OS |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-[[1-(4-fluorophenyl)-4,5,6,7-tetrahydroindazole-3-carbonyl]amino]thiourea |
| SMILES | Cc1cccc(NC(=S)NNC(=O)c2nn(-c3ccc(F)cc3)c3c2CCCC3)c1C |
| InChI | InChI=1S/C23H24FN5OS/c1-14-6-5-8-19(15(14)2)25-23(31)27-26-22(30)21-18-7-3-4-9-20(18)29(28-21)17-12-10-16(24)11-13-17/h5-6,8,10-13H,3-4,7,9H2,1-2H3,(H,26,30)(H2,25,27,31) |
| InChIKey | PQXYNWCELUQQPU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_C(9)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|