C20H17F3N4O2 — CID 94145652
(E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]prop-2-enamide (PubChem CID 94145652) has the molecular formula C20H17F3N4O2 and a molecular weight of 402.38 g/mol. Its IUPAC name is (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]prop-2-enamide.
| Compound Name | (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 94145652 |
| Molecular Formula | C20H17F3N4O2 |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]prop-2-enamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1/C=C/C(=O)Nc1cc(C(F)(F)F)c[nH]c1=O |
| InChI | InChI=1S/C20H17F3N4O2/c1-12-16(13(2)27(26-12)15-6-4-3-5-7-15)8-9-18(28)25-17-10-14(20(21,22)23)11-24-19(17)29/h3-11H,1-2H3,(H,24,29)(H,25,28)/b9-8+ |
| InChIKey | PWSIIRWUSNXVHJ-CMDGGOBGSA-N |
| XLogP | 3.85 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|