C21H25ClN2O4 — CID 7904671
(5-acetyl-2-methoxyphenyl)methyl (E)-3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]prop-2-enoate (PubChem CID 7904671) has the molecular formula C21H25ClN2O4 and a molecular weight of 404.89 g/mol. Its IUPAC name is (5-acetyl-2-methoxyphenyl)methyl (E)-3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]prop-2-enoate.
| Compound Name | (5-acetyl-2-methoxyphenyl)methyl (E)-3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 7904671 |
| Molecular Formula | C21H25ClN2O4 |
| Molecular Weight | 404.89 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | (5-acetyl-2-methoxyphenyl)methyl (E)-3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]prop-2-enoate |
| SMILES | COc1ccc(C(C)=O)cc1COC(=O)/C=C/c1c(C)nn(CC(C)C)c1Cl |
| InChI | InChI=1S/C21H25ClN2O4/c1-13(2)11-24-21(22)18(14(3)23-24)7-9-20(26)28-12-17-10-16(15(4)25)6-8-19(17)27-5/h6-10,13H,11-12H2,1-5H3/b9-7+ |
| InChIKey | WYPSFMWBPYXLIO-VQHVLOKHSA-N |
| XLogP | 4.47 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.89 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|