C21H26ClN3O4 — CID 76859674
methyl 5-[[3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]prop-2-enoylamino]methyl]-2-methoxybenzoate (PubChem CID 76859674) has the molecular formula C21H26ClN3O4 and a molecular weight of 419.91 g/mol. Its IUPAC name is methyl 5-[[3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]prop-2-enoylamino]methyl]-2-methoxybenzoate.
| Compound Name | methyl 5-[[3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]prop-2-enoylamino]methyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 76859674 |
| Molecular Formula | C21H26ClN3O4 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | methyl 5-[[3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]prop-2-enoylamino]methyl]-2-methoxybenzoate |
| SMILES | COC(=O)c1cc(CNC(=O)C=Cc2c(C)nn(CC(C)C)c2Cl)ccc1OC |
| InChI | InChI=1S/C21H26ClN3O4/c1-13(2)12-25-20(22)16(14(3)24-25)7-9-19(26)23-11-15-6-8-18(28-4)17(10-15)21(27)29-5/h6-10,13H,11-12H2,1-5H3,(H,23,26) |
| InChIKey | WLHMCAMYZRTVOF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|