C17H20ClN3O3 — CID 51305031
(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-[(3,4-dimethoxyphenyl)methyl]prop-2-enamide (PubChem CID 51305031) has the molecular formula C17H20ClN3O3 and a molecular weight of 349.82 g/mol. Its IUPAC name is (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-[(3,4-dimethoxyphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-[(3,4-dimethoxyphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 51305031 |
| Molecular Formula | C17H20ClN3O3 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-[(3,4-dimethoxyphenyl)methyl]prop-2-enamide |
| SMILES | COc1ccc(CNC(=O)/C=C/c2c(C)nn(C)c2Cl)cc1OC |
| InChI | InChI=1S/C17H20ClN3O3/c1-11-13(17(18)21(2)20-11)6-8-16(22)19-10-12-5-7-14(23-3)15(9-12)24-4/h5-9H,10H2,1-4H3,(H,19,22)/b8-6+ |
| InChIKey | NLMNVMMIBWTJFJ-SOFGYWHQSA-N |
| XLogP | 2.73 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|