C23H31ClN4O3S — CID 76879853
3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]-N-[(3-piperidin-1-ylsulfonylphenyl)methyl]prop-2-enamide (PubChem CID 76879853) has the molecular formula C23H31ClN4O3S and a molecular weight of 479.05 g/mol. Its IUPAC name is 3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]-N-[(3-piperidin-1-ylsulfonylphenyl)methyl]prop-2-enamide.
| Compound Name | 3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]-N-[(3-piperidin-1-ylsulfonylphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 76879853 |
| Molecular Formula | C23H31ClN4O3S |
| Molecular Weight | 479.05 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]-N-[(3-piperidin-1-ylsulfonylphenyl)methyl]prop-2-enamide |
| SMILES | Cc1nn(CC(C)C)c(Cl)c1C=CC(=O)NCc1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C23H31ClN4O3S/c1-17(2)16-28-23(24)21(18(3)26-28)10-11-22(29)25-15-19-8-7-9-20(14-19)32(30,31)27-12-5-4-6-13-27/h7-11,14,17H,4-6,12-13,15-16H2,1-3H3,(H,25,29) |
| InChIKey | YJNCEFNADCSHJS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.05 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|